C34H37FN4 — CID 142378310
[4-(2-fluorophenyl)-8-methyl-2-quinolin-4-yl-5,6,6a,7,10,10a-hexahydrobenzo[h]quinazolin-9-yl]methanimine;2-methylbutane (PubChem CID 142378310) has the molecular formula C34H37FN4 and a molecular weight of 520.70 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-8-methyl-2-quinolin-4-yl-5,6,6a,7,10,10a-hexahydrobenzo[h]quinazolin-9-yl]methanimine;2-methylbutane.
| Compound Name | [4-(2-fluorophenyl)-8-methyl-2-quinolin-4-yl-5,6,6a,7,10,10a-hexahydrobenzo[h]quinazolin-9-yl]methanimine;2-methylbutane |
|---|---|
| PubChem CID | 142378310 |
| Molecular Formula | C34H37FN4 |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | [4-(2-fluorophenyl)-8-methyl-2-quinolin-4-yl-5,6,6a,7,10,10a-hexahydrobenzo[h]quinazolin-9-yl]methanimine;2-methylbutane |
| SMILES | CCC(C)C.[H]/N=C/C1=C(C)CC2CCc3c(-c4ccccc4F)nc(-c4ccnc5ccccc45)nc3C2C1 |
| InChI | InChI=1S/C29H25FN4.C5H12/c1-17-14-18-10-11-23-27(22-7-2-4-8-25(22)30)33-29(34-28(23)24(18)15-19(17)16-31)21-12-13-32-26-9-5-3-6-20(21)26;1-4-5(2)3/h2-9,12-13,16,18,24,31H,10-11,14-15H2,1H3;5H,4H2,1-3H3/b31-16+; |
| InChIKey | UIRKUGVMDBGIRY-IILCOTAFSA-N |
| XLogP | 8.96 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|