C47H95NO4 — CID 142378832
heptadecan-9-yl 8-[[(6R)-8-butyl-6-hydroxyhexadecyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 142378832) has the molecular formula C47H95NO4 and a molecular weight of 738.28 g/mol. Its IUPAC name is heptadecan-9-yl 8-[[(6R)-8-butyl-6-hydroxyhexadecyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[[(6R)-8-butyl-6-hydroxyhexadecyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 142378832 |
| Molecular Formula | C47H95NO4 |
| Molecular Weight | 738.28 g/mol |
| Exact Mass | 737.73 |
| IUPAC Name | heptadecan-9-yl 8-[[(6R)-8-butyl-6-hydroxyhexadecyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCC(CCCC)C[C@H](O)CCCCCN(CCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C47H95NO4/c1-5-9-13-16-20-26-34-44(33-12-8-4)43-45(50)35-27-25-32-40-48(41-42-49)39-31-24-19-23-30-38-47(51)52-46(36-28-21-17-14-10-6-2)37-29-22-18-15-11-7-3/h44-46,49-50H,5-43H2,1-4H3/t44?,45-/m1/s1 |
| InChIKey | ADZWGJVHHMCLSQ-BWSSJUFOSA-N |
| XLogP | 13.90 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.28 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|