C30H21N3O2 — CID 142384476
13-hydroxy-3-methyl-20,30-dimethylidene-3,13,23-triazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),4,6,8,12(21),14,16,18,24,26,28-dodecaen-10-one (PubChem CID 142384476) has the molecular formula C30H21N3O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 13-hydroxy-3-methyl-20,30-dimethylidene-3,13,23-triazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),4,6,8,12(21),14,16,18,24,26,28-dodecaen-10-one.
| Compound Name | 13-hydroxy-3-methyl-20,30-dimethylidene-3,13,23-triazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),4,6,8,12(21),14,16,18,24,26,28-dodecaen-10-one |
|---|---|
| PubChem CID | 142384476 |
| Molecular Formula | C30H21N3O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 13-hydroxy-3-methyl-20,30-dimethylidene-3,13,23-triazaheptacyclo[20.8.0.02,11.04,9.012,21.014,19.024,29]triaconta-1(22),2(11),4,6,8,12(21),14,16,18,24,26,28-dodecaen-10-one |
| SMILES | C=C1c2ccccc2N(O)c2c1c1c(c3c2c(=O)c2ccccc2n3C)C(=C)c2ccccc2N1 |
| InChI | InChI=1S/C30H21N3O2/c1-16-18-10-4-7-13-21(18)31-27-24(16)28-26(30(34)20-12-6-8-14-22(20)32(28)3)29-25(27)17(2)19-11-5-9-15-23(19)33(29)35/h4-15,31,35H,1-2H2,3H3 |
| InChIKey | AAZPFONXNKRYRU-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|