C18H23N — CID 142385260
N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine (PubChem CID 142385260) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine.
| Compound Name | N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine |
|---|---|
| PubChem CID | 142385260 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine |
| SMILES | C=C/C=C\C(=C/C)C(=C)C=C(N=C)/C(C=C)=C/CC |
| InChI | InChI=1S/C18H23N/c1-7-11-13-16(9-3)15(5)14-18(19-6)17(10-4)12-8-2/h7,9-14H,1,4-6,8H2,2-3H3/b13-11-,16-9+,17-12+,18-14- |
| InChIKey | YMYLDTHCNZRTSB-LAPJSIFVSA-N |
| XLogP | 5.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|