C21H39N3 — CID 142386338
ethane;N-methyl-3-[4-[(5Z)-5-[(Z)-prop-1-enyl]octa-5,7-dienyl]piperazin-1-yl]prop-1-en-2-amine (PubChem CID 142386338) has the molecular formula C21H39N3 and a molecular weight of 333.56 g/mol. Its IUPAC name is ethane;N-methyl-3-[4-[(5Z)-5-[(Z)-prop-1-enyl]octa-5,7-dienyl]piperazin-1-yl]prop-1-en-2-amine.
| Compound Name | ethane;N-methyl-3-[4-[(5Z)-5-[(Z)-prop-1-enyl]octa-5,7-dienyl]piperazin-1-yl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 142386338 |
| Molecular Formula | C21H39N3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.31 |
| IUPAC Name | ethane;N-methyl-3-[4-[(5Z)-5-[(Z)-prop-1-enyl]octa-5,7-dienyl]piperazin-1-yl]prop-1-en-2-amine |
| SMILES | C=C/C=C(\C=C/C)CCCCN1CCN(CC(=C)NC)CC1.CC |
| InChI | InChI=1S/C19H33N3.C2H6/c1-5-9-19(10-6-2)11-7-8-12-21-13-15-22(16-14-21)17-18(3)20-4;1-2/h5-6,9-10,20H,1,3,7-8,11-17H2,2,4H3;1-2H3/b10-6-,19-9+; |
| InChIKey | IRVUEGCKGZKHQL-NTSFVJHFSA-N |
| XLogP | 4.22 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|