C9H16N4 — CID 142392764
2-[amino(propan-2-yl)amino]benzene-1,4-diamine (PubChem CID 142392764) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[amino(propan-2-yl)amino]benzene-1,4-diamine.
| Compound Name | 2-[amino(propan-2-yl)amino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 142392764 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-[amino(propan-2-yl)amino]benzene-1,4-diamine |
| SMILES | CC(C)N(N)c1cc(N)ccc1N |
| InChI | InChI=1S/C9H16N4/c1-6(2)13(12)9-5-7(10)3-4-8(9)11/h3-6H,10-12H2,1-2H3 |
| InChIKey | ZVGGHYXMYXDBDA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|