C22H30F2N2 — CID 142397589
(3E)-4-N-(4,5-difluoro-2-methylphenyl)-3-ethylidene-2-N-[(E)-pent-1-enyl]octane-2,4-diimine (PubChem CID 142397589) has the molecular formula C22H30F2N2 and a molecular weight of 360.49 g/mol. Its IUPAC name is (3E)-4-N-(4,5-difluoro-2-methylphenyl)-3-ethylidene-2-N-[(E)-pent-1-enyl]octane-2,4-diimine.
| Compound Name | (3E)-4-N-(4,5-difluoro-2-methylphenyl)-3-ethylidene-2-N-[(E)-pent-1-enyl]octane-2,4-diimine |
|---|---|
| PubChem CID | 142397589 |
| Molecular Formula | C22H30F2N2 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | (3E)-4-N-(4,5-difluoro-2-methylphenyl)-3-ethylidene-2-N-[(E)-pent-1-enyl]octane-2,4-diimine |
| SMILES | C/C=C(C(\C)=N\C=C\CCC)/C(CCCC)=N/c1cc(F)c(F)cc1C |
| InChI | InChI=1S/C22H30F2N2/c1-6-9-11-13-25-17(5)18(8-3)21(12-10-7-2)26-22-15-20(24)19(23)14-16(22)4/h8,11,13-15H,6-7,9-10,12H2,1-5H3/b13-11+,18-8+,25-17+,26-21+ |
| InChIKey | OHIKHJWVICAHFU-CECAEUBMSA-N |
| XLogP | 7.26 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|