C11H9ClF5NOS — CID 142404702
2-[(2,3,4,5,6-pentafluorophenyl)sulfanyl-propylamino]acetyl chloride (PubChem CID 142404702) has the molecular formula C11H9ClF5NOS and a molecular weight of 333.71 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentafluorophenyl)sulfanyl-propylamino]acetyl chloride.
| Compound Name | 2-[(2,3,4,5,6-pentafluorophenyl)sulfanyl-propylamino]acetyl chloride |
|---|---|
| PubChem CID | 142404702 |
| Molecular Formula | C11H9ClF5NOS |
| Molecular Weight | 333.71 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-[(2,3,4,5,6-pentafluorophenyl)sulfanyl-propylamino]acetyl chloride |
| SMILES | CCCN(CC(=O)Cl)Sc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H9ClF5NOS/c1-2-3-18(4-5(12)19)20-11-9(16)7(14)6(13)8(15)10(11)17/h2-4H2,1H3 |
| InChIKey | DDPDRNWLFJTKSG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|