C14H26N2O — CID 142409695
N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 142409695) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142409695 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N'-[3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | C=C/C=C\C(=C)OCCCN(C)CCN(C)C |
| InChI | InChI=1S/C14H26N2O/c1-6-7-9-14(2)17-13-8-10-16(5)12-11-15(3)4/h6-7,9H,1-2,8,10-13H2,3-5H3/b9-7- |
| InChIKey | FSPMGMKRYHVFIK-CLFYSBASSA-N |
| XLogP | 2.14 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|