C27H26ClN7O3 — CID 142413863
7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 142413863) has the molecular formula C27H26ClN7O3 and a molecular weight of 532.00 g/mol. Its IUPAC name is 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 142413863 |
| Molecular Formula | C27H26ClN7O3 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-(morpholin-4-ylmethyl)phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(CN5CCOCC5)cc4)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C27H26ClN7O3/c1-36-20-12-21(24(28)23(13-20)37-2)22-11-18-14-29-27(32-25(18)35-16-30-33-26(22)35)31-19-5-3-17(4-6-19)15-34-7-9-38-10-8-34/h3-6,11-14,16H,7-10,15H2,1-2H3,(H,29,31,32) |
| InChIKey | PKCCJOWYVJUGKD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |