C40H42OP2 — CID 142416138
[(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-phenyl-[7-(2-phenylphosphanylphenoxy)cyclohepta-1,3,6-trien-1-yl]phosphane;toluene (PubChem CID 142416138) has the molecular formula C40H42OP2 and a molecular weight of 600.72 g/mol. Its IUPAC name is [(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-phenyl-[7-(2-phenylphosphanylphenoxy)cyclohepta-1,3,6-trien-1-yl]phosphane;toluene.
| Compound Name | [(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-phenyl-[7-(2-phenylphosphanylphenoxy)cyclohepta-1,3,6-trien-1-yl]phosphane;toluene |
|---|---|
| PubChem CID | 142416138 |
| Molecular Formula | C40H42OP2 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | [(2Z,4E)-6-methylhepta-2,4-dien-4-yl]-phenyl-[7-(2-phenylphosphanylphenoxy)cyclohepta-1,3,6-trien-1-yl]phosphane;toluene |
| SMILES | C/C=C\C(=C/C(C)C)P(C1=CC=CCC=C1Oc1ccccc1Pc1ccccc1)c1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C33H34OP2.C7H8/c1-4-16-29(25-26(2)3)36(28-19-10-6-11-20-28)33-24-13-7-12-22-31(33)34-30-21-14-15-23-32(30)35-27-17-8-5-9-18-27;1-7-5-3-2-4-6-7/h4-11,13-26,35H,12H2,1-3H3;2-6H,1H3/b16-4-,29-25+; |
| InChIKey | SUJSFDLNYREZMD-IQDAVKQESA-N |
| XLogP | 10.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|