C28H43N5 — CID 142416963
N-cyclopropyl-N'-[3-[(dimethylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-N'-ethylethane-1,2-diamine;5,6,7,8-tetrahydroquinoline (PubChem CID 142416963) has the molecular formula C28H43N5 and a molecular weight of 449.69 g/mol. Its IUPAC name is N-cyclopropyl-N'-[3-[(dimethylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-N'-ethylethane-1,2-diamine;5,6,7,8-tetrahydroquinoline.
| Compound Name | N-cyclopropyl-N'-[3-[(dimethylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-N'-ethylethane-1,2-diamine;5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 142416963 |
| Molecular Formula | C28H43N5 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | N-cyclopropyl-N'-[3-[(dimethylamino)methyl]-1,2,3,4-tetrahydroisoquinolin-5-yl]-N'-ethylethane-1,2-diamine;5,6,7,8-tetrahydroquinoline |
| SMILES | CCN(CCNC1CC1)c1cccc2c1CC(CN(C)C)NC2.c1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H32N4.C9H11N/c1-4-23(11-10-20-16-8-9-16)19-7-5-6-15-13-21-17(12-18(15)19)14-22(2)3;1-2-6-9-8(4-1)5-3-7-10-9/h5-7,16-17,20-21H,4,8-14H2,1-3H3;3,5,7H,1-2,4,6H2 |
| InChIKey | UEGASNOUIBQGIJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |