C20H17NO7S — CID 142436527
phenyl (2R)-2-amino-3-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]propanoate (PubChem CID 142436527) has the molecular formula C20H17NO7S and a molecular weight of 415.42 g/mol. Its IUPAC name is phenyl (2R)-2-amino-3-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]propanoate.
| Compound Name | phenyl (2R)-2-amino-3-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]propanoate |
|---|---|
| PubChem CID | 142436527 |
| Molecular Formula | C20H17NO7S |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | phenyl (2R)-2-amino-3-[(2-oxo-5-phenyl-1,3-dioxol-4-yl)methoxycarbonylsulfanyl]propanoate |
| SMILES | N[C@@H](CSC(=O)OCc1oc(=O)oc1-c1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C20H17NO7S/c21-15(18(22)26-14-9-5-2-6-10-14)12-29-20(24)25-11-16-17(28-19(23)27-16)13-7-3-1-4-8-13/h1-10,15H,11-12,21H2/t15-/m0/s1 |
| InChIKey | RTOSBLNMXPTHOS-HNNXBMFYSA-N |
| XLogP | 3.20 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|