C22H32O3S — CID 142437251
6-methyl-4-phenylsulfanyl-oxacyclohexadecane-2,5-dione (PubChem CID 142437251) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is 6-methyl-4-phenylsulfanyl-oxacyclohexadecane-2,5-dione.
| Compound Name | 6-methyl-4-phenylsulfanyl-oxacyclohexadecane-2,5-dione |
|---|---|
| PubChem CID | 142437251 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 6-methyl-4-phenylsulfanyl-oxacyclohexadecane-2,5-dione |
| SMILES | CC1CCCCCCCCCCOC(=O)CC(Sc2ccccc2)C1=O |
| InChI | InChI=1S/C22H32O3S/c1-18-13-9-6-4-2-3-5-7-12-16-25-21(23)17-20(22(18)24)26-19-14-10-8-11-15-19/h8,10-11,14-15,18,20H,2-7,9,12-13,16-17H2,1H3 |
| InChIKey | KRVBVNAXIWHNTO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |