C23H22FN3O4 — CID 142440264
[3-[(2-ethoxy-5-ethylbenzoyl)amino]-4-fluorobenzenecarboximidoyl] furan-2-carboximidate (PubChem CID 142440264) has the molecular formula C23H22FN3O4 and a molecular weight of 423.44 g/mol. Its IUPAC name is [3-[(2-ethoxy-5-ethylbenzoyl)amino]-4-fluorobenzenecarboximidoyl] furan-2-carboximidate.
| Compound Name | [3-[(2-ethoxy-5-ethylbenzoyl)amino]-4-fluorobenzenecarboximidoyl] furan-2-carboximidate |
|---|---|
| PubChem CID | 142440264 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [3-[(2-ethoxy-5-ethylbenzoyl)amino]-4-fluorobenzenecarboximidoyl] furan-2-carboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccco1)c1ccc(F)c(NC(=O)c2cc(CC)ccc2OCC)c1 |
| InChI | InChI=1S/C23H22FN3O4/c1-3-14-7-10-19(29-4-2)16(12-14)23(28)27-18-13-15(8-9-17(18)24)21(25)31-22(26)20-6-5-11-30-20/h5-13,25-26H,3-4H2,1-2H3,(H,27,28)/b25-21-,26-22+ |
| InChIKey | HPUXERDKYCXVDO-KOUJMYIZSA-N |
| XLogP | 5.00 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|