C23H18ClF2NO3 — CID 142452780
5-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-6-(4-ethynyl-2,6-difluorophenyl)pyridin-2-one (PubChem CID 142452780) has the molecular formula C23H18ClF2NO3 and a molecular weight of 429.85 g/mol. Its IUPAC name is 5-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-6-(4-ethynyl-2,6-difluorophenyl)pyridin-2-one.
| Compound Name | 5-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-6-(4-ethynyl-2,6-difluorophenyl)pyridin-2-one |
|---|---|
| PubChem CID | 142452780 |
| Molecular Formula | C23H18ClF2NO3 |
| Molecular Weight | 429.85 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 5-(2-chloro-3,5-dimethoxyphenyl)-1-ethyl-6-(4-ethynyl-2,6-difluorophenyl)pyridin-2-one |
| SMILES | C#Cc1cc(F)c(-c2c(-c3cc(OC)cc(OC)c3Cl)ccc(=O)n2CC)c(F)c1 |
| InChI | InChI=1S/C23H18ClF2NO3/c1-5-13-9-17(25)21(18(26)10-13)23-15(7-8-20(28)27(23)6-2)16-11-14(29-3)12-19(30-4)22(16)24/h1,7-12H,6H2,2-4H3 |
| InChIKey | PNRLYRNLHKEBKE-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|