C32H42BrO2P — CID 142458632
8-[bromo-tris(3,5-dimethylphenyl)-λ5-phosphanyl]octanoic acid (PubChem CID 142458632) has the molecular formula C32H42BrO2P and a molecular weight of 569.56 g/mol. Its IUPAC name is 8-[bromo-tris(3,5-dimethylphenyl)-λ5-phosphanyl]octanoic acid.
| Compound Name | 8-[bromo-tris(3,5-dimethylphenyl)-λ5-phosphanyl]octanoic acid |
|---|---|
| PubChem CID | 142458632 |
| Molecular Formula | C32H42BrO2P |
| Molecular Weight | 569.56 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 8-[bromo-tris(3,5-dimethylphenyl)-λ5-phosphanyl]octanoic acid |
| SMILES | Cc1cc(C)cc(P(Br)(CCCCCCCC(=O)O)(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C32H42BrO2P/c1-23-14-24(2)18-29(17-23)36(33,30-19-25(3)15-26(4)20-30,31-21-27(5)16-28(6)22-31)13-11-9-7-8-10-12-32(34)35/h14-22H,7-13H2,1-6H3,(H,34,35) |
| InChIKey | USWDQJWGDUNOAV-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.56 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|