C13H10O — CID 142466952
8-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene (PubChem CID 142466952) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is 8-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene.
| Compound Name | 8-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene |
|---|---|
| PubChem CID | 142466952 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 8-oxatetracyclo[7.5.0.02,7.010,12]tetradeca-1(9),2,4,6,13-pentaene |
| SMILES | C1=CC2CC2c2oc3ccccc3c21 |
| InChI | InChI=1S/C13H10O/c1-2-4-12-9(3-1)10-6-5-8-7-11(8)13(10)14-12/h1-6,8,11H,7H2 |
| InChIKey | PTBQCONZISEJEG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |