C25H34 — CID 143846018
8,9-bis(ethenyl)tetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene;ethane (PubChem CID 143846018) has the molecular formula C25H34 and a molecular weight of 334.55 g/mol. Its IUPAC name is 8,9-bis(ethenyl)tetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene;ethane.
| Compound Name | 8,9-bis(ethenyl)tetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene;ethane |
|---|---|
| PubChem CID | 143846018 |
| Molecular Formula | C25H34 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 8,9-bis(ethenyl)tetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene;ethane |
| SMILES | C=Cc1c2c(c3ccccc3c1C=C)C1CC1C=C2.CC.CC.CC |
| InChI | InChI=1S/C19H16.3C2H6/c1-3-13-14(4-2)17-10-9-12-11-18(12)19(17)16-8-6-5-7-15(13)16;3*1-2/h3-10,12,18H,1-2,11H2;3*1-2H3 |
| InChIKey | IAOYKMZFRUMYCR-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |