C12H9N3O2 — CID 151477234
(3R,4S)-4-azido-3,4-dihydrodibenzofuran-3-ol (PubChem CID 151477234) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is (3R,4S)-4-azido-3,4-dihydrodibenzofuran-3-ol.
| Compound Name | (3R,4S)-4-azido-3,4-dihydrodibenzofuran-3-ol |
|---|---|
| PubChem CID | 151477234 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (3R,4S)-4-azido-3,4-dihydrodibenzofuran-3-ol |
| SMILES | [N-]=[N+]=N[C@@H]1c2oc3ccccc3c2C=C[C@H]1O |
| InChI | InChI=1S/C12H9N3O2/c13-15-14-11-9(16)6-5-8-7-3-1-2-4-10(7)17-12(8)11/h1-6,9,11,16H/t9-,11+/m1/s1 |
| InChIKey | PLSBWCAVIUZGBU-KOLCDFICSA-N |
| XLogP | 3.17 |
| TPSA | 82.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|