C36H52O3S — CID 142467813
S-[(7R,17S)-10,13,17-trimethyl-3-oxo-17-(3-oxobutyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl] 2-(1-adamantyl)ethanethioate (PubChem CID 142467813) has the molecular formula C36H52O3S and a molecular weight of 564.88 g/mol. Its IUPAC name is S-[(7R,17S)-10,13,17-trimethyl-3-oxo-17-(3-oxobutyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl] 2-(1-adamantyl)ethanethioate.
| Compound Name | S-[(7R,17S)-10,13,17-trimethyl-3-oxo-17-(3-oxobutyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl] 2-(1-adamantyl)ethanethioate |
|---|---|
| PubChem CID | 142467813 |
| Molecular Formula | C36H52O3S |
| Molecular Weight | 564.88 g/mol |
| Exact Mass | 564.36 |
| IUPAC Name | S-[(7R,17S)-10,13,17-trimethyl-3-oxo-17-(3-oxobutyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-yl] 2-(1-adamantyl)ethanethioate |
| SMILES | CC(=O)CC[C@]1(C)CCC2C3C(SC(=O)CC45CC6CC(CC(C6)C4)C5)CC4=CC(=O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C36H52O3S/c1-22(37)5-9-33(2)10-7-29-32-28(8-12-35(29,33)4)34(3)11-6-27(38)16-26(34)17-30(32)40-31(39)21-36-18-23-13-24(19-36)15-25(14-23)20-36/h16,23-25,28-30,32H,5-15,17-21H2,1-4H3/t23?,24?,25?,28?,29?,30?,32?,33-,34?,35?,36?/m1/s1 |
| InChIKey | PMGINFZLTNPQHJ-GQASGAEKSA-N |
| XLogP | 8.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.88 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|