About (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine
(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine (PubChem CID 142468581) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine.
Molecular Properties
| Compound Name | (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine |
| PubChem CID | 142468581 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine |
| SMILES | [H]/N=C/C(C=C)=C(\N)C=C |
| InChI | InChI=1S/C7H10N2/c1-3-6(5-8)7(9)4-2/h3-5,8H,1-2,9H2/b7-6-,8-5+ |
| InChIKey | JXVIKQDTBAKFQX-WNXMRAAYSA-N |
| XLogP | 1.22 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
The IUPAC name of (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine (CID 142468581) is (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine.
What is the SMILES notation for (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
The canonical SMILES for (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine is [H]/N=C/C(C=C)=C(\N)C=C.
What is the InChIKey of (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
The InChIKey is JXVIKQDTBAKFQX-WNXMRAAYSA-N. The full InChI is InChI=1S/C7H10N2/c1-3-6(5-8)7(9)4-2/h3-5,8H,1-2,9H2/b7-6-,8-5+.
What are the key properties of (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine?
(3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine has a molecular weight of 122.17 g/mol, XLogP of 1.22, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-methanimidoylhexa-1,3,5-trien-3-amine is sourced from PubChem (CID 142468581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).