C22H19NO2S — CID 142480080
3-hydroxy-5-[3-[4-(2-phenylethynyl)phenyl]propylsulfanyl]-1H-pyridin-2-one (PubChem CID 142480080) has the molecular formula C22H19NO2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 3-hydroxy-5-[3-[4-(2-phenylethynyl)phenyl]propylsulfanyl]-1H-pyridin-2-one.
| Compound Name | 3-hydroxy-5-[3-[4-(2-phenylethynyl)phenyl]propylsulfanyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 142480080 |
| Molecular Formula | C22H19NO2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-hydroxy-5-[3-[4-(2-phenylethynyl)phenyl]propylsulfanyl]-1H-pyridin-2-one |
| SMILES | O=c1[nH]cc(SCCCc2ccc(C#Cc3ccccc3)cc2)cc1O |
| InChI | InChI=1S/C22H19NO2S/c24-21-15-20(16-23-22(21)25)26-14-4-7-18-9-12-19(13-10-18)11-8-17-5-2-1-3-6-17/h1-3,5-6,9-10,12-13,15-16,24H,4,7,14H2,(H,23,25) |
| InChIKey | STMVUMFCEIULSG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|