C54H47N — CID 142480316
[6'-[(3E,5Z)-7-[4-(3-cyclohexa-1,5-dien-1-ylphenyl)cyclohexa-1,3-dien-1-yl]hepta-1,3,5-trien-4-yl]-9,9-dimethylspiro[anthracene-10,9'-fluorene]-4'-yl]methanimine (PubChem CID 142480316) has the molecular formula C54H47N and a molecular weight of 709.98 g/mol. Its IUPAC name is [6'-[(3E,5Z)-7-[4-(3-cyclohexa-1,5-dien-1-ylphenyl)cyclohexa-1,3-dien-1-yl]hepta-1,3,5-trien-4-yl]-9,9-dimethylspiro[anthracene-10,9'-fluorene]-4'-yl]methanimine.
| Compound Name | [6'-[(3E,5Z)-7-[4-(3-cyclohexa-1,5-dien-1-ylphenyl)cyclohexa-1,3-dien-1-yl]hepta-1,3,5-trien-4-yl]-9,9-dimethylspiro[anthracene-10,9'-fluorene]-4'-yl]methanimine |
|---|---|
| PubChem CID | 142480316 |
| Molecular Formula | C54H47N |
| Molecular Weight | 709.98 g/mol |
| Exact Mass | 709.37 |
| IUPAC Name | [6'-[(3E,5Z)-7-[4-(3-cyclohexa-1,5-dien-1-ylphenyl)cyclohexa-1,3-dien-1-yl]hepta-1,3,5-trien-4-yl]-9,9-dimethylspiro[anthracene-10,9'-fluorene]-4'-yl]methanimine |
| SMILES | [H]/N=C\c1cccc2c1-c1cc(C(/C=C\CC3=CC=C(c4cccc(C5=CCCC=C5)c4)CC3)=C/C=C)ccc1C21c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C54H47N/c1-4-15-38(19-12-16-37-28-30-40(31-29-37)42-21-13-20-41(34-42)39-17-6-5-7-18-39)43-32-33-46-45(35-43)52-44(36-55)22-14-27-51(52)54(46)49-25-10-8-23-47(49)53(2,3)48-24-9-11-26-50(48)54/h4,6,8-15,17-28,30,32-36,55H,1,5,7,16,29,31H2,2-3H3/b19-12-,38-15+,55-36- |
| InChIKey | KQFXLJPSCAKIBJ-JQXUTOEMSA-N |
| XLogP | 13.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.98 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|