C34H32N3O7+ — CID 142492737
1,3,4-tris[[2-(1H-indol-3-yl)acetyl]oxy]butan-2-yloxidanium (PubChem CID 142492737) has the molecular formula C34H32N3O7+ and a molecular weight of 594.64 g/mol. Its IUPAC name is 1,3,4-tris[[2-(1H-indol-3-yl)acetyl]oxy]butan-2-yloxidanium.
| Compound Name | 1,3,4-tris[[2-(1H-indol-3-yl)acetyl]oxy]butan-2-yloxidanium |
|---|---|
| PubChem CID | 142492737 |
| Molecular Formula | C34H32N3O7+ |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 1,3,4-tris[[2-(1H-indol-3-yl)acetyl]oxy]butan-2-yloxidanium |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCC([OH2+])C(COC(=O)Cc1c[nH]c2ccccc12)OC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C34H31N3O7/c38-30(19-42-32(39)13-21-16-35-27-10-4-1-7-24(21)27)31(44-34(41)15-23-18-37-29-12-6-3-9-26(23)29)20-43-33(40)14-22-17-36-28-11-5-2-8-25(22)28/h1-12,16-18,30-31,35-38H,13-15,19-20H2/p+1 |
| InChIKey | KIZMFURGVQVZCD-UHFFFAOYSA-O |
| XLogP | 4.25 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|