C15H15F6NO — CID 14249337
1,1,1,3,3,3-hexafluoro-2-(2,2,4-trimethyl-1H-quinolin-6-yl)propan-2-ol (PubChem CID 14249337) has the molecular formula C15H15F6NO and a molecular weight of 339.28 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(2,2,4-trimethyl-1H-quinolin-6-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(2,2,4-trimethyl-1H-quinolin-6-yl)propan-2-ol |
|---|---|
| PubChem CID | 14249337 |
| Molecular Formula | C15H15F6NO |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(2,2,4-trimethyl-1H-quinolin-6-yl)propan-2-ol |
| SMILES | CC1=CC(C)(C)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C15H15F6NO/c1-8-7-12(2,3)22-11-5-4-9(6-10(8)11)13(23,14(16,17)18)15(19,20)21/h4-7,22-23H,1-3H3 |
| InChIKey | NWZLXPLQLLKOAL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |