C20H29N — CID 142494530
(4E)-N-[(Z)-but-2-enyl]-4-ethyl-3-methyl-5-(4-methylphenyl)hexa-1,4-dien-2-amine (PubChem CID 142494530) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is (4E)-N-[(Z)-but-2-enyl]-4-ethyl-3-methyl-5-(4-methylphenyl)hexa-1,4-dien-2-amine.
| Compound Name | (4E)-N-[(Z)-but-2-enyl]-4-ethyl-3-methyl-5-(4-methylphenyl)hexa-1,4-dien-2-amine |
|---|---|
| PubChem CID | 142494530 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | (4E)-N-[(Z)-but-2-enyl]-4-ethyl-3-methyl-5-(4-methylphenyl)hexa-1,4-dien-2-amine |
| SMILES | C=C(NC/C=C\C)C(C)/C(CC)=C(\C)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H29N/c1-7-9-14-21-18(6)16(4)20(8-2)17(5)19-12-10-15(3)11-13-19/h7,9-13,16,21H,6,8,14H2,1-5H3/b9-7-,20-17+ |
| InChIKey | LSWBZNVXFFTEMN-SIOOWMBNSA-N |
| XLogP | 5.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|