C19H27BN2O6 — CID 142508014
oxan-4-yl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate (PubChem CID 142508014) has the molecular formula C19H27BN2O6 and a molecular weight of 390.25 g/mol. Its IUPAC name is oxan-4-yl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate.
| Compound Name | oxan-4-yl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
|---|---|
| PubChem CID | 142508014 |
| Molecular Formula | C19H27BN2O6 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | oxan-4-yl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
| SMILES | CC1(C)OB(c2cnc3c(c2)N(C(=O)OC2CCOCC2)CCO3)OC1(C)C |
| InChI | InChI=1S/C19H27BN2O6/c1-18(2)19(3,4)28-20(27-18)13-11-15-16(21-12-13)25-10-7-22(15)17(23)26-14-5-8-24-9-6-14/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | OLXFUHGHDBHCPO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|