C31H40N4 — CID 142510994
2-[4-cyclobutylidene-2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine (PubChem CID 142510994) has the molecular formula C31H40N4 and a molecular weight of 468.69 g/mol. Its IUPAC name is 2-[4-cyclobutylidene-2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine.
| Compound Name | 2-[4-cyclobutylidene-2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine |
|---|---|
| PubChem CID | 142510994 |
| Molecular Formula | C31H40N4 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.33 |
| IUPAC Name | 2-[4-cyclobutylidene-2-[(4Z)-5-ethyl-6-methylhepta-2,4,6-trien-3-yl]pyrido[1,2-a]pyrimidin-7-yl]-3,4,6,7,10,10a-hexahydro-1H-pyrazino[1,2-a]azepine |
| SMILES | C=C(C)/C(=C\C(=CC)C1=CC(=C2CCC2)N2C=C(N3CCN4CCC=CCC4C3)C=CC2=N1)CC |
| InChI | InChI=1S/C31H40N4/c1-5-24(23(3)4)19-25(6-2)29-20-30(26-11-10-12-26)35-22-28(14-15-31(35)32-29)34-18-17-33-16-9-7-8-13-27(33)21-34/h6-8,14-15,19-20,22,27H,3,5,9-13,16-18,21H2,1-2,4H3/b24-19-,25-6? |
| InChIKey | UVFZYULYZJTMAC-ZCLYPYPGSA-N |
| XLogP | 6.63 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|