C24H31N5 — CID 142511302
(2E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine (PubChem CID 142511302) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is (2E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511302 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | (2E)-1-(4-cyclobutylidene-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-2-yl)-N,3,4-trimethylpenta-2,4-dien-1-imine |
| SMILES | C=C(C)/C(C)=C/C(=N\C)C1=CC(=C2CCC2)N2C=C(N3CCNCC3)C=CC2=N1 |
| InChI | InChI=1S/C24H31N5/c1-17(2)18(3)14-21(25-4)22-15-23(19-6-5-7-19)29-16-20(8-9-24(29)27-22)28-12-10-26-11-13-28/h8-9,14-16,26H,1,5-7,10-13H2,2-4H3/b18-14+,25-21+ |
| InChIKey | OSAJQDKEFSLAFP-WOIJOENLSA-N |
| XLogP | 3.93 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|