C31H42N4 — CID 142511392
4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrazino[1,2-a]pyrimidine (PubChem CID 142511392) has the molecular formula C31H42N4 and a molecular weight of 470.71 g/mol. Its IUPAC name is 4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrazino[1,2-a]pyrimidine.
| Compound Name | 4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrazino[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 142511392 |
| Molecular Formula | C31H42N4 |
| Molecular Weight | 470.71 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 4-methylidene-7-(1,2,3,6-tetrahydropyridin-4-yl)-2-[(3E,5E,10Z)-2,3,11,12-tetramethyltetradeca-1,3,5,10-tetraen-5-yl]pyrazino[1,2-a]pyrimidine |
| SMILES | C=C(C)/C(C)=C/C(=C\CCC/C=C(/C)C(C)CC)C1=CC(=C)N2C=C(C3=CCNCC3)N=CC2=N1 |
| InChI | InChI=1S/C31H42N4/c1-8-23(4)24(5)12-10-9-11-13-28(18-25(6)22(2)3)29-19-26(7)35-21-30(33-20-31(35)34-29)27-14-16-32-17-15-27/h12-14,18-21,23,32H,2,7-11,15-17H2,1,3-6H3/b24-12-,25-18+,28-13+ |
| InChIKey | FJULHAJULFEISI-UHXAXJJCSA-N |
| XLogP | 7.56 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.71 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|