C22H29N5 — CID 142511433
(2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine (PubChem CID 142511433) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is (2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine.
| Compound Name | (2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511433 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | (2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine |
| SMILES | C=C/C(C)=C/C(=N\C)C1=CC(=C)N2C=C(N3CC(C)NC(C)C3)C=CC2=N1 |
| InChI | InChI=1S/C22H29N5/c1-7-15(2)10-20(23-6)21-11-18(5)27-14-19(8-9-22(27)25-21)26-12-16(3)24-17(4)13-26/h7-11,14,16-17,24H,1,5,12-13H2,2-4,6H3/b15-10+,23-20+ |
| InChIKey | GSJLGUOGIJRVLG-NSFTWKFUSA-N |
| XLogP | 3.39 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|