C22H35N5S2 — CID 142522955
5-[amino(methylidene)-λ4-sulfanyl]-2-tert-butyl-1,3-thiazole;ethenamine;1,2,3,5,6,7-hexahydro-s-indacene-1,8-diamine (PubChem CID 142522955) has the molecular formula C22H35N5S2 and a molecular weight of 433.69 g/mol. Its IUPAC name is 5-[amino(methylidene)-λ4-sulfanyl]-2-tert-butyl-1,3-thiazole;ethenamine;1,2,3,5,6,7-hexahydro-s-indacene-1,8-diamine.
| Compound Name | 5-[amino(methylidene)-λ4-sulfanyl]-2-tert-butyl-1,3-thiazole;ethenamine;1,2,3,5,6,7-hexahydro-s-indacene-1,8-diamine |
|---|---|
| PubChem CID | 142522955 |
| Molecular Formula | C22H35N5S2 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 5-[amino(methylidene)-λ4-sulfanyl]-2-tert-butyl-1,3-thiazole;ethenamine;1,2,3,5,6,7-hexahydro-s-indacene-1,8-diamine |
| SMILES | C=CN.C=S(N)c1cnc(C(C)(C)C)s1.Nc1c2c(cc3c1C(N)CC3)CCC2 |
| InChI | InChI=1S/C12H16N2.C8H14N2S2.C2H5N/c13-10-5-4-8-6-7-2-1-3-9(7)12(14)11(8)10;1-8(2,3)7-10-5-6(11-7)12(4)9;1-2-3/h6,10H,1-5,13-14H2;5H,4,9H2,1-3H3;2H,1,3H2 |
| InChIKey | WNQKSGOKQRVYMG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|