C23H28N2O6S — CID 142525643
N-[5-(1,3-benzothiazol-2-yl)-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]acetamide (PubChem CID 142525643) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is N-[5-(1,3-benzothiazol-2-yl)-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]acetamide.
| Compound Name | N-[5-(1,3-benzothiazol-2-yl)-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 142525643 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[5-(1,3-benzothiazol-2-yl)-2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2nc3ccccc3s2)ccc1OCCOCCOCCOCCO |
| InChI | InChI=1S/C23H28N2O6S/c1-17(27)24-20-16-18(23-25-19-4-2-3-5-22(19)32-23)6-7-21(20)31-15-14-30-13-12-29-11-10-28-9-8-26/h2-7,16,26H,8-15H2,1H3,(H,24,27) |
| InChIKey | OMDMOQPBWZCPGA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|