C24H31NO6S — CID 142525652
2-[2-[2-[2-[4-(1,3-benzothiazol-2-yl)-2-(2-methoxyethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 142525652) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-(1,3-benzothiazol-2-yl)-2-(2-methoxyethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[4-(1,3-benzothiazol-2-yl)-2-(2-methoxyethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 142525652 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 2-[2-[2-[2-[4-(1,3-benzothiazol-2-yl)-2-(2-methoxyethyl)phenoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | COCCc1cc(-c2nc3ccccc3s2)ccc1OCCOCCOCCOCCO |
| InChI | InChI=1S/C24H31NO6S/c1-27-10-8-19-18-20(24-25-21-4-2-3-5-23(21)32-24)6-7-22(19)31-17-16-30-15-14-29-13-12-28-11-9-26/h2-7,18,26H,8-17H2,1H3 |
| InChIKey | QFHXIEYNJSUQEX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|