C20H20N2O2S — CID 174769562
(E)-N-[5-(1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)phenyl]but-2-en-1-imine (PubChem CID 174769562) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is (E)-N-[5-(1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)phenyl]but-2-en-1-imine.
| Compound Name | (E)-N-[5-(1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)phenyl]but-2-en-1-imine |
|---|---|
| PubChem CID | 174769562 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (E)-N-[5-(1,3-benzothiazol-2-yl)-2-(2-methoxyethoxy)phenyl]but-2-en-1-imine |
| SMILES | C/C=C/C=N/c1cc(-c2nc3ccccc3s2)ccc1OCCOC |
| InChI | InChI=1S/C20H20N2O2S/c1-3-4-11-21-17-14-15(9-10-18(17)24-13-12-23-2)20-22-16-7-5-6-8-19(16)25-20/h3-11,14H,12-13H2,1-2H3/b4-3+,21-11+ |
| InChIKey | OWQBQOSXLHVDKQ-QJRDPUHFSA-N |
| XLogP | 5.27 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|