C9H9ClNS+ — CID 142525849
(2-ethyl-1,3-benzothiazol-5-yl)chloranium (PubChem CID 142525849) has the molecular formula C9H9ClNS+ and a molecular weight of 198.70 g/mol. Its IUPAC name is (2-ethyl-1,3-benzothiazol-5-yl)chloranium.
| Compound Name | (2-ethyl-1,3-benzothiazol-5-yl)chloranium |
|---|---|
| PubChem CID | 142525849 |
| Molecular Formula | C9H9ClNS+ |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (2-ethyl-1,3-benzothiazol-5-yl)chloranium |
| SMILES | CCc1nc2cc([ClH+])ccc2s1 |
| InChI | InChI=1S/C9H9ClNS/c1-2-9-11-7-5-6(10)3-4-8(7)12-9/h3-5,10H,2H2,1H3/q+1 |
| InChIKey | IYDXZFYLCLRFTG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |