C17H15ClN6OS — CID 142530947
4-(chloromethyl)-10-(6,7-dihydro-1H-indazol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 142530947) has the molecular formula C17H15ClN6OS and a molecular weight of 386.87 g/mol. Its IUPAC name is 4-(chloromethyl)-10-(6,7-dihydro-1H-indazol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 4-(chloromethyl)-10-(6,7-dihydro-1H-indazol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 142530947 |
| Molecular Formula | C17H15ClN6OS |
| Molecular Weight | 386.87 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 4-(chloromethyl)-10-(6,7-dihydro-1H-indazol-4-ylmethyl)-7-methyl-3-thia-5,7,10,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | Cn1c2nc(CCl)sc2c2cnn(CC3=CCCc4[nH]ncc43)c(=O)c21 |
| InChI | InChI=1S/C17H15ClN6OS/c1-23-14-11(15-16(23)21-13(5-18)26-15)7-20-24(17(14)25)8-9-3-2-4-12-10(9)6-19-22-12/h3,6-7H,2,4-5,8H2,1H3,(H,19,22) |
| InChIKey | WRZNBXDHVPSVFM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.87 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|