C10H20N2 — CID 142531750
(Z)-3-(ethyliminomethyl)hept-2-en-4-amine (PubChem CID 142531750) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (Z)-3-(ethyliminomethyl)hept-2-en-4-amine.
| Compound Name | (Z)-3-(ethyliminomethyl)hept-2-en-4-amine |
|---|---|
| PubChem CID | 142531750 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (Z)-3-(ethyliminomethyl)hept-2-en-4-amine |
| SMILES | C/C=C(\C=N\CC)C(N)CCC |
| InChI | InChI=1S/C10H20N2/c1-4-7-10(11)9(5-2)8-12-6-3/h5,8,10H,4,6-7,11H2,1-3H3/b9-5+,12-8+ |
| InChIKey | CSXWKLNVGIPIQE-PIHCAMFYSA-N |
| XLogP | 2.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|