C21H26F3NO2 — CID 142538597
4-[2-[(2-ethyl-2-methylpyrrolidin-1-yl)methyl]-5-(trifluoromethyl)phenyl]-2,2-dimethylbut-3-ynoic acid (PubChem CID 142538597) has the molecular formula C21H26F3NO2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[2-[(2-ethyl-2-methylpyrrolidin-1-yl)methyl]-5-(trifluoromethyl)phenyl]-2,2-dimethylbut-3-ynoic acid.
| Compound Name | 4-[2-[(2-ethyl-2-methylpyrrolidin-1-yl)methyl]-5-(trifluoromethyl)phenyl]-2,2-dimethylbut-3-ynoic acid |
|---|---|
| PubChem CID | 142538597 |
| Molecular Formula | C21H26F3NO2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 4-[2-[(2-ethyl-2-methylpyrrolidin-1-yl)methyl]-5-(trifluoromethyl)phenyl]-2,2-dimethylbut-3-ynoic acid |
| SMILES | CCC1(C)CCCN1Cc1ccc(C(F)(F)F)cc1C#CC(C)(C)C(=O)O |
| InChI | InChI=1S/C21H26F3NO2/c1-5-20(4)10-6-12-25(20)14-16-7-8-17(21(22,23)24)13-15(16)9-11-19(2,3)18(26)27/h7-8,13H,5-6,10,12,14H2,1-4H3,(H,26,27) |
| InChIKey | SJDQHBDGHNXMFC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|