C27H29N — CID 142540837
N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine;toluene (PubChem CID 142540837) has the molecular formula C27H29N and a molecular weight of 367.54 g/mol. Its IUPAC name is N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine;toluene.
| Compound Name | N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine;toluene |
|---|---|
| PubChem CID | 142540837 |
| Molecular Formula | C27H29N |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | N-phenylbicyclo[4.1.0]hepta-2,4-dien-3-amine;toluene |
| SMILES | C1=CC2CC2C=C1Nc1ccccc1.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C13H13N.2C7H8/c1-2-4-12(5-3-1)14-13-7-6-10-8-11(10)9-13;2*1-7-5-3-2-4-6-7/h1-7,9-11,14H,8H2;2*2-6H,1H3 |
| InChIKey | YCSBRRSBFRSVCB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |