About trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate
trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate (PubChem CID 142541642) has the molecular formula C17H14Cl3NO2
and a molecular weight of 370.66 g/mol. Its IUPAC name is trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate.
Molecular Properties
| Compound Name | trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate |
| PubChem CID | 142541642 |
| Molecular Formula | C17H14Cl3NO2 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate |
| SMILES | O=C(OC(Cl)(Cl)Cl)[C@@]1(c2ccccc2)NCCc2ccccc21 |
| InChI | InChI=1S/C17H14Cl3NO2/c18-17(19,20)23-15(22)16(13-7-2-1-3-8-13)14-9-5-4-6-12(14)10-11-21-16/h1-9,21H,10-11H2/t16-/m0/s1 |
| InChIKey | NGSMPPRKIAOFCJ-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate?
The IUPAC name of trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate (CID 142541642) is trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate.
What is the SMILES notation for trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate?
The canonical SMILES for trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate is O=C(OC(Cl)(Cl)Cl)[C@@]1(c2ccccc2)NCCc2ccccc21.
What is the InChIKey of trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate?
The InChIKey is NGSMPPRKIAOFCJ-INIZCTEOSA-N. The full InChI is InChI=1S/C17H14Cl3NO2/c18-17(19,20)23-15(22)16(13-7-2-1-3-8-13)14-9-5-4-6-12(14)10-11-21-16/h1-9,21H,10-11H2/t16-/m0/s1.
What are the key properties of trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate?
trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate has a molecular weight of 370.66 g/mol, XLogP of 3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate is sourced from PubChem (CID 142541642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).