C17H14Cl3NO2 — CID 142541642
trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate (PubChem CID 142541642) has the molecular formula C17H14Cl3NO2 and a molecular weight of 370.66 g/mol. Its IUPAC name is trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate.
| Compound Name | trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate |
|---|---|
| PubChem CID | 142541642 |
| Molecular Formula | C17H14Cl3NO2 |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | trichloromethyl (1S)-1-phenyl-3,4-dihydro-2H-isoquinoline-1-carboxylate |
| SMILES | O=C(OC(Cl)(Cl)Cl)[C@@]1(c2ccccc2)NCCc2ccccc21 |
| InChI | InChI=1S/C17H14Cl3NO2/c18-17(19,20)23-15(22)16(13-7-2-1-3-8-13)14-9-5-4-6-12(14)10-11-21-16/h1-9,21H,10-11H2/t16-/m0/s1 |
| InChIKey | NGSMPPRKIAOFCJ-INIZCTEOSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|