About (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride
(1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride (PubChem CID 87238689) has the molecular formula C16H13ClINO
and a molecular weight of 397.64 g/mol. Its IUPAC name is (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride.
Molecular Properties
| Compound Name | (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride |
| PubChem CID | 87238689 |
| Molecular Formula | C16H13ClINO |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride |
| SMILES | O=C(Cl)[C@]1(c2ccccc2I)NCCc2ccccc21 |
| InChI | InChI=1S/C16H13ClINO/c17-15(20)16(13-7-3-4-8-14(13)18)12-6-2-1-5-11(12)9-10-19-16/h1-8,19H,9-10H2/t16-/m0/s1 |
| InChIKey | LXMMVOIQNGJWTO-INIZCTEOSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride?
The IUPAC name of (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride (CID 87238689) is (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride.
What is the SMILES notation for (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride?
The canonical SMILES for (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride is O=C(Cl)[C@]1(c2ccccc2I)NCCc2ccccc21.
What is the InChIKey of (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride?
The InChIKey is LXMMVOIQNGJWTO-INIZCTEOSA-N. The full InChI is InChI=1S/C16H13ClINO/c17-15(20)16(13-7-3-4-8-14(13)18)12-6-2-1-5-11(12)9-10-19-16/h1-8,19H,9-10H2/t16-/m0/s1.
What are the key properties of (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride?
(1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride has a molecular weight of 397.64 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(2-iodophenyl)-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride is sourced from PubChem (CID 87238689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).