C11H12IN2O2- — CID 23197413
N-[1-(iodomethyl)-3,4-dihydro-2H-isoquinolin-1-yl]carbamate (PubChem CID 23197413) has the molecular formula C11H12IN2O2- and a molecular weight of 331.13 g/mol. Its IUPAC name is N-[1-(iodomethyl)-3,4-dihydro-2H-isoquinolin-1-yl]carbamate.
| Compound Name | N-[1-(iodomethyl)-3,4-dihydro-2H-isoquinolin-1-yl]carbamate |
|---|---|
| PubChem CID | 23197413 |
| Molecular Formula | C11H12IN2O2- |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-[1-(iodomethyl)-3,4-dihydro-2H-isoquinolin-1-yl]carbamate |
| SMILES | O=C([O-])NC1(CI)NCCc2ccccc21 |
| InChI | InChI=1S/C11H13IN2O2/c12-7-11(14-10(15)16)9-4-2-1-3-8(9)5-6-13-11/h1-4,13-14H,5-7H2,(H,15,16)/p-1 |
| InChIKey | KZWCKNHREKWBCI-UHFFFAOYSA-M |
| XLogP | 0.35 |
| TPSA | 64.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|