C16H14ClNO — CID 87238687
1-phenyl-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride (PubChem CID 87238687) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 1-phenyl-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride.
| Compound Name | 1-phenyl-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride |
|---|---|
| PubChem CID | 87238687 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-phenyl-3,4-dihydro-2H-isoquinoline-1-carbonyl chloride |
| SMILES | O=C(Cl)C1(c2ccccc2)NCCc2ccccc21 |
| InChI | InChI=1S/C16H14ClNO/c17-15(19)16(13-7-2-1-3-8-13)14-9-5-4-6-12(14)10-11-18-16/h1-9,18H,10-11H2 |
| InChIKey | LWAJRKAWLDLZOJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|