C18H31N — CID 142547914
(2E,5Z)-2,7-dimethyl-4-propan-2-ylidene-N-propylocta-2,5,7-trien-1-imine;ethane (PubChem CID 142547914) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (2E,5Z)-2,7-dimethyl-4-propan-2-ylidene-N-propylocta-2,5,7-trien-1-imine;ethane.
| Compound Name | (2E,5Z)-2,7-dimethyl-4-propan-2-ylidene-N-propylocta-2,5,7-trien-1-imine;ethane |
|---|---|
| PubChem CID | 142547914 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (2E,5Z)-2,7-dimethyl-4-propan-2-ylidene-N-propylocta-2,5,7-trien-1-imine;ethane |
| SMILES | C=C(C)/C=C\C(/C=C(C)\C=N\CCC)=C(C)C.CC |
| InChI | InChI=1S/C16H25N.C2H6/c1-7-10-17-12-15(6)11-16(14(4)5)9-8-13(2)3;1-2/h8-9,11-12H,2,7,10H2,1,3-6H3;1-2H3/b9-8-,15-11+,17-12+; |
| InChIKey | XGSSGTCHYVLJQC-GRXOAQRRSA-N |
| XLogP | 5.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|