C14H19FO3 — CID 142549107
(1S,5R)-3-benzyl-6,8-dioxabicyclo[3.2.1]octan-4-ol;fluoromethane (PubChem CID 142549107) has the molecular formula C14H19FO3 and a molecular weight of 254.30 g/mol. Its IUPAC name is (1S,5R)-3-benzyl-6,8-dioxabicyclo[3.2.1]octan-4-ol;fluoromethane.
| Compound Name | (1S,5R)-3-benzyl-6,8-dioxabicyclo[3.2.1]octan-4-ol;fluoromethane |
|---|---|
| PubChem CID | 142549107 |
| Molecular Formula | C14H19FO3 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (1S,5R)-3-benzyl-6,8-dioxabicyclo[3.2.1]octan-4-ol;fluoromethane |
| SMILES | CF.OC1C(Cc2ccccc2)C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C13H16O3.CH3F/c14-12-10(6-9-4-2-1-3-5-9)7-11-8-15-13(12)16-11;1-2/h1-5,10-14H,6-8H2;1H3/t10?,11-,12?,13+;/m0./s1 |
| InChIKey | WYBRDDVDFBNADX-DOLRKMKKSA-N |
| XLogP | 1.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |