C17H33NO — CID 142550038
(2E)-N-hexyl-5-methoxy-N-propylhepta-2,6-dien-1-amine (PubChem CID 142550038) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is (2E)-N-hexyl-5-methoxy-N-propylhepta-2,6-dien-1-amine.
| Compound Name | (2E)-N-hexyl-5-methoxy-N-propylhepta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 142550038 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | (2E)-N-hexyl-5-methoxy-N-propylhepta-2,6-dien-1-amine |
| SMILES | C=CC(C/C=C/CN(CCC)CCCCCC)OC |
| InChI | InChI=1S/C17H33NO/c1-5-8-9-11-15-18(14-6-2)16-12-10-13-17(7-3)19-4/h7,10,12,17H,3,5-6,8-9,11,13-16H2,1-2,4H3/b12-10+ |
| InChIKey | BQLMAJMRCHISCT-ZRDIBKRKSA-N |
| XLogP | 4.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|