C10H13NO — CID 142555742
4-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine (PubChem CID 142555742) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine.
| Compound Name | 4-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine |
|---|---|
| PubChem CID | 142555742 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-ethyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine |
| SMILES | CCc1ccnc2c1CCOC2 |
| InChI | InChI=1S/C10H13NO/c1-2-8-3-5-11-10-7-12-6-4-9(8)10/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | MWVCLYFWTPGSER-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |