C14H19N5OS — CID 142574787
N-[5-amino-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentyl]acetamide (PubChem CID 142574787) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is N-[5-amino-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentyl]acetamide.
| Compound Name | N-[5-amino-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 142574787 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[5-amino-1-(5-pyridin-2-yl-1,3,4-thiadiazol-2-yl)pentyl]acetamide |
| SMILES | CC(=O)NC(CCCCN)c1nnc(-c2ccccn2)s1 |
| InChI | InChI=1S/C14H19N5OS/c1-10(20)17-12(7-2-4-8-15)14-19-18-13(21-14)11-6-3-5-9-16-11/h3,5-6,9,12H,2,4,7-8,15H2,1H3,(H,17,20) |
| InChIKey | UUUUMJURIZEFGO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|